CAS 911109-16-5 appears in our catalog under these names: 8-Hydroxyquinoline-3-carboxylic acid, 95%, 8-hydroxyquinoline-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
8-hydroxyquinoline-3-carboxylic acid (CAS 911109-16-5) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 8-hydroxyquinoline-3-carboxylic acid. InChIKey: ZANGALOTOWAFFM-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 8-hydroxyquinoline-3-carboxylic acid |
| InChIKey | ZANGALOTOWAFFM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)O)C(=O)O |
Computed by PubChem (NCBI)