Products 91137-55-2
CAS 91137-55-2 appears in our catalog under these names: 4-Methyl-2-phenyl-1,3-oxazole-5-carboxylic acid, 95%, 4-Methyl-2-phenyl-1,3-oxazole-5-carboxylic acid, 97% , 4-Methyl-2-phenyloxazole-5-carboxylic acid, 95+%, 95+%, 4-Methyl-2-phenyl-1,3-oxazole-5-carboxylic acid, 95+%. Offered by: Combi-blocks, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 100mg, 1g.
4-methyl-2-phenyl-1,3-oxazole-5-carboxylic acid (CAS 91137-55-2) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 4-methyl-2-phenyl-1,3-oxazole-5-carboxylic acid. InChIKey: HRFYZRHGBICKAG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 4-methyl-2-phenyl-1,3-oxazole-5-carboxylic acid |
| InChIKey | HRFYZRHGBICKAG-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)