CAS 91147-06-7 is the registry number for Spirobroussonin A. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6,7-dihydroxy-3'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,6'-cyclohexa-2,4-diene]-1'-one (CAS 91147-06-7) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 6,7-dihydroxy-3'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,6'-cyclohexa-2,4-diene]-1'-one. InChIKey: XJXYCCLGSHWCRC-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 6,7-dihydroxy-3'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,6'-cyclohexa-2,4-diene]-1'-one |
| InChIKey | XJXYCCLGSHWCRC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)C2(CCCC3=CC(=C(C=C32)O)O)C=C1 |
Computed by PubChem (NCBI)