Products 911714-91-5
CAS 911714-91-5 is the registry number for Chrysothol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
(1R,2S,3R,6S,7S,10R)-3,7-dimethyl-10-propan-2-yl-11-oxatricyclo[5.3.1.02,6]undecan-3-ol (CAS 911714-91-5) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: (1R,2S,3R,6S,7S,10R)-3,7-dimethyl-10-propan-2-yl-11-oxatricyclo[5.3.1.02,6]undecan-3-ol. InChIKey: PEWNHOBTYNZGAR-FSKVPOERSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | (1R,2S,3R,6S,7S,10R)-3,7-dimethyl-10-propan-2-yl-11-oxatricyclo[5.3.1.02,6]undecan-3-ol |
| InChIKey | PEWNHOBTYNZGAR-FSKVPOERSA-N |
| SMILES | CC(C)[C@H]1CC[C@]2([C@H]3CC[C@@]([C@@H]3[C@@H]1O2)(C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Chrysothol, orb1682947