CAS 912969-54-1 is the registry number for 4-Chloro-N-phenyl-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-N-phenyl-1,3-thiazol-2-amine (CAS 912969-54-1) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 4-chloro-N-phenyl-1,3-thiazol-2-amine. InChIKey: GLCQDXAIQSLCAX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 4-chloro-N-phenyl-1,3-thiazol-2-amine |
| InChIKey | GLCQDXAIQSLCAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=CS2)Cl |
Computed by PubChem (NCBI)