CAS 913848-94-9 appears in our catalog under these names: 4-(1H-Pyrazol-1-yl)aniline hydrochloride, 95%, 4-(1H-Pyrazol-1-yl)aniline hydrochloride, 96%, 4-(1H-Pyrazol-1-yl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 25g, 2,5g, 0,25g.
4-pyrazol-1-ylaniline;hydrochloride (CAS 913848-94-9) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 4-pyrazol-1-ylaniline;hydrochloride. InChIKey: COQNHFGHPQKJAV-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 4-pyrazol-1-ylaniline;hydrochloride |
| InChIKey | COQNHFGHPQKJAV-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)