CAS 91442-24-9 appears in our catalog under these names: 2-([1,1'-Biphenyl]-2-yloxy)ethyl Acrylate (stabilized with MEHQ), >90.0%(HPLC), 2-([1,1'-Biphenyl]-2-yloxy)ethyl acrylate, 98%, 98%, 2-([1,1'-BIPHENYL]-2-YLOXY)ETHYL ACRYLATE, 98%, 2-([1,1'-Biphenyl]-2-yloxy)ethyl acrylate, 97% +(stabilized with MEHQ). Offered by: TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 500g, 1g, 5g, 10g, 250mg.
2-(2-phenylphenoxy)ethyl prop-2-enoate (CAS 91442-24-9) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: 2-(2-phenylphenoxy)ethyl prop-2-enoate. InChIKey: VAZQKPWSBFZARZ-UHFFFAOYSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-(2-phenylphenoxy)ethyl prop-2-enoate |
| InChIKey | VAZQKPWSBFZARZ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOC1=CC=CC=C1C2=CC=CC=C2 |
Computed by PubChem (NCBI)