Products 91497-93-7
CAS 91497-93-7 appears in our catalog under these names: 1-(3,4,5-Trimethoxyphenyl)propane-1,2-dione, 97%, 2-hydroxy-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(3,4,5-trimethoxyphenyl)propane-1,2-dione (CAS 91497-93-7) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 1-(3,4,5-trimethoxyphenyl)propane-1,2-dione. InChIKey: VVOZHPFXUTYWDY-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1-(3,4,5-trimethoxyphenyl)propane-1,2-dione |
| InChIKey | VVOZHPFXUTYWDY-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)