CAS 915923-21-6 is the registry number for 2-(2-Bromophenyl)-5-methyl-1,3,4-thiadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-(2-bromophenyl)-5-methyl-1,3,4-thiadiazole (CAS 915923-21-6) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 2-(2-bromophenyl)-5-methyl-1,3,4-thiadiazole. InChIKey: SILPBHNEWDTMAT-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 2-(2-bromophenyl)-5-methyl-1,3,4-thiadiazole |
| InChIKey | SILPBHNEWDTMAT-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)