CAS 63615-95-2 appears in our catalog under these names: 5-Bromo-N-phenylthiazol-2-amine, 95%, 5–Bromo–N–phenylthiazol–2–amine. Offered by: AmBeed, GLPBio. Available pack sizes: 10g, 25g, 5g, 100mg, 1g, 250mg.
5-bromo-N-phenyl-1,3-thiazol-2-amine (CAS 63615-95-2) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 5-bromo-N-phenyl-1,3-thiazol-2-amine. InChIKey: GZYZRVABKWWEMZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 5-bromo-N-phenyl-1,3-thiazol-2-amine |
| InChIKey | GZYZRVABKWWEMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(S2)Br |
Computed by PubChem (NCBI)