CAS 163798-92-3 appears in our catalog under these names: 4-[4-(Bromomethyl)phenyl]-1,2,3-thiadiazole, 95%, 4-[4-(Bromomethyl)phenyl]-1,2,3-thiadiazole, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 1g.
4-[4-(bromomethyl)phenyl]thiadiazole (CAS 163798-92-3) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 4-[4-(bromomethyl)phenyl]thiadiazole. InChIKey: DGHQOPZIGDRUIT-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 4-[4-(bromomethyl)phenyl]thiadiazole |
| InChIKey | DGHQOPZIGDRUIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2=CSN=N2 |
Computed by PubChem (NCBI)