CAS 73040-60-5 appears in our catalog under these names: 5-(4-Bromophenyl)-1,3-thiazol-2-amine, 5-(4-Bromophenyl)thiazol-2-amine 95%, 5-(4-bromophenyl)-1,3-thiazol-2-amine, 95%, 5-(4-Bromophenyl)thiazol-2-amine, >98.0%(HPLC), 5-(4-bromophenyl)-1,3-thiazol-2-amine, 95%, 95%. Offered by: Biosynth, Ambeed, Combi-blocks, TCI, Chemat. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 10g.
5-(4-bromophenyl)-1,3-thiazol-2-amine (CAS 73040-60-5) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 5-(4-bromophenyl)-1,3-thiazol-2-amine. InChIKey: FZXHXJYHJOHEIV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,3-thiazol-2-amine |
| InChIKey | FZXHXJYHJOHEIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(S2)N)Br |
Computed by PubChem (NCBI)