CAS 1204608-91-2 appears in our catalog under these names: 3-(5-Bromo-4-methyl-1,3-thiazol-2-yl)pyridine, 95%, 3-(5-Bromo-4-methyl-1,3-thiazol-2-yl)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-4-methyl-2-pyridin-3-yl-1,3-thiazole (CAS 1204608-91-2) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 5-bromo-4-methyl-2-pyridin-3-yl-1,3-thiazole. InChIKey: OVXXBKHKCMYBTB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 5-bromo-4-methyl-2-pyridin-3-yl-1,3-thiazole |
| InChIKey | OVXXBKHKCMYBTB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CN=CC=C2)Br |
Computed by PubChem (NCBI)