CAS 850245-47-5 appears in our catalog under these names: 2-(5-Bromo-4-methyl-1,3-thiazol-2-yl)pyridine, 95%, 2-(5-bromo-4-methyl-1,3-thiazol-2-yl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-4-methyl-2-pyridin-2-yl-1,3-thiazole (CAS 850245-47-5) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 5-bromo-4-methyl-2-pyridin-2-yl-1,3-thiazole. InChIKey: YZMFMRJEMAPOCP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 5-bromo-4-methyl-2-pyridin-2-yl-1,3-thiazole |
| InChIKey | YZMFMRJEMAPOCP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=N2)Br |
Computed by PubChem (NCBI)