CAS 915944-27-3 appears in our catalog under these names: 1,2-Bis(bromomethyl)-4,5-difluorobenzene, 95%, 95%, 1,2-Bis(bromomethyl)-4,5-difluorobenzene, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,2-bis(bromomethyl)-4,5-difluorobenzene (CAS 915944-27-3) is a chemical compound with the molecular formula C8H6Br2F2 and a molecular weight of 299.94 g/mol. IUPAC name: 1,2-bis(bromomethyl)-4,5-difluorobenzene. InChIKey: QCQHUMBPYQAMGI-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2 |
|---|---|
| Molecular weight | 299.94 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)-4,5-difluorobenzene |
| InChIKey | QCQHUMBPYQAMGI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)CBr)CBr |
Computed by PubChem (NCBI)