Products 915977-08-1
CAS 915977-08-1 is the registry number for 4-Chloro-6-methoxy-1,5-naphthyridin-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-6-methoxy-1,5-naphthyridin-3-amine (CAS 915977-08-1) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: 4-chloro-6-methoxy-1,5-naphthyridin-3-amine. InChIKey: XNTIILULKFVYTC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 4-chloro-6-methoxy-1,5-naphthyridin-3-amine |
| InChIKey | XNTIILULKFVYTC-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C(=CN=C2C=C1)N)Cl |
Computed by PubChem (NCBI)