Products 916056-81-0
CAS 916056-81-0 is the registry number for RASP-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol (CAS 916056-81-0) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: 2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol. InChIKey: PMUCJUMJDCRIRS-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol |
| InChIKey | PMUCJUMJDCRIRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C=C1N)N=C(O2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)