CAS 916220-05-8 appears in our catalog under these names: 3-(4-Chloro-2-methylphenyl)benzoic acid, 96%, 4'-Chloro-2'-methyl-(1,1'-biphenyl)-3-carboxylic acid, 98%, 4'-Chloro-2'-methyl-[1,1'-biphenyl]-3-carboxylic acid 96%, 4'-Chloro-2'-methyl-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95%, 4'-Chloro-2'-methyl-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-(4-chloro-2-methylphenyl)benzoic acid (CAS 916220-05-8) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 3-(4-chloro-2-methylphenyl)benzoic acid. InChIKey: DFYRPLGXXFUTLB-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 3-(4-chloro-2-methylphenyl)benzoic acid |
| InChIKey | DFYRPLGXXFUTLB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)