Products 916420-48-9
CAS 916420-48-9 is the registry number for 2-Chloro-4,6-bis(trifluoromethyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-4,6-bis(trifluoromethyl)benzaldehyde (CAS 916420-48-9) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 2-chloro-4,6-bis(trifluoromethyl)benzaldehyde. InChIKey: FFSCXVIOXOGOIT-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF6O |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 2-chloro-4,6-bis(trifluoromethyl)benzaldehyde |
| InChIKey | FFSCXVIOXOGOIT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)C=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)