CAS 785-56-8 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)benzoyl chloride, 95%, 3,5–Bis(trifluoromethyl)benzoyl chloride, 3,5-Bis(trifluoromethyl)benzoyl chloride, 97%, 3,5-Bis(trifluoromethyl)benzoyl Chloride, >98.0%(T), 3,5-bis(trifluoromethyl)benzoylchloride 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 250g.
3,5-bis(trifluoromethyl)benzoyl chloride (CAS 785-56-8) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)benzoyl chloride. InChIKey: WAKMMQSMEDJRRI-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF6O |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)benzoyl chloride |
| InChIKey | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)