CAS 393-82-8 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)benzoyl chloride, 95%, 2,5–Bis(trifluoromethyl)benzoyl chloride, 2,5-Bis(trifluoromethyl)benzoyl Chloride, >98.0%(GC)(T), 2,5-Bis(trifluoromethyl)benzoylchloride 98%, 2,5-Bis(trifluoromethyl)benzoyl chloride, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
2,5-bis(trifluoromethyl)benzoyl chloride (CAS 393-82-8) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)benzoyl chloride. InChIKey: LRJNPOCQOZWIGR-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF6O |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)benzoyl chloride |
| InChIKey | LRJNPOCQOZWIGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)