Products 53130-43-1

CAS 53130-43-1 is the registry number for 2,4-Bis(trifluoromethyl)benzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2,4-bis(trifluoromethyl)benzoyl chloride (CAS 53130-43-1) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)benzoyl chloride. InChIKey: TZXHEDOCQVTEPT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H3ClF6O
Molecular weight276.56 g/mol
IUPAC name2,4-bis(trifluoromethyl)benzoyl chloride
InChIKeyTZXHEDOCQVTEPT-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)