Products 53130-44-2

CAS 53130-44-2 appears in our catalog under these names: 2,6-Bis(trifluoromethyl)benzoyl chloride, 95%, 2,6-Bis(trifluoromethyl)benzoyl chloride 95+%, 2,6-Bis(trifluoromethyl)benzoyl chloride, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 250mg, 5g, 10g.

2,6-bis(trifluoromethyl)benzoyl chloride (CAS 53130-44-2) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)benzoyl chloride. InChIKey: NQMCJGTVZMBTDS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H3ClF6O
Molecular weight276.56 g/mol
IUPAC name2,6-bis(trifluoromethyl)benzoyl chloride
InChIKeyNQMCJGTVZMBTDS-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)C(F)(F)F)C(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)