CAS 53130-44-2 appears in our catalog under these names: 2,6-Bis(trifluoromethyl)benzoyl chloride, 95%, 2,6-Bis(trifluoromethyl)benzoyl chloride 95+%, 2,6-Bis(trifluoromethyl)benzoyl chloride, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 250mg, 5g, 10g.
2,6-bis(trifluoromethyl)benzoyl chloride (CAS 53130-44-2) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)benzoyl chloride. InChIKey: NQMCJGTVZMBTDS-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF6O |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)benzoyl chloride |
| InChIKey | NQMCJGTVZMBTDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)