Products 916582-66-6
CAS 916582-66-6 is the registry number for (3,5-Diaminophenyl)methyl (2E)-3-phenyl-2-propenoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3,5-diaminophenyl)methyl (E)-3-phenylprop-2-enoate (CAS 916582-66-6) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: (3,5-diaminophenyl)methyl (E)-3-phenylprop-2-enoate. InChIKey: QAZVDPRQTCENSC-VOTSOKGWSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (3,5-diaminophenyl)methyl (E)-3-phenylprop-2-enoate |
| InChIKey | QAZVDPRQTCENSC-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)OCC2=CC(=CC(=C2)N)N |
Computed by PubChem (NCBI)