CAS 916764-89-1 is the registry number for 6–Chloro–1–(4–methoxybenzyl)–3–methylpyrimidine–2,4(1H,3H)–dione. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
6-chloro-1-[(4-methoxyphenyl)methyl]-3-methylpyrimidine-2,4-dione (CAS 916764-89-1) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: 6-chloro-1-[(4-methoxyphenyl)methyl]-3-methylpyrimidine-2,4-dione. InChIKey: NINZAMOQCXMUNF-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | 6-chloro-1-[(4-methoxyphenyl)methyl]-3-methylpyrimidine-2,4-dione |
| InChIKey | NINZAMOQCXMUNF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(N(C1=O)CC2=CC=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)