CAS 91715-78-5 appears in our catalog under these names: 1-(4-Bromo-3-nitrophenyl)butan-1-one, 98%, 1-(4-Bromo-3-nitrophenyl)butan-1-one, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
1-(4-bromo-3-nitrophenyl)butan-1-one (CAS 91715-78-5) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: 1-(4-bromo-3-nitrophenyl)butan-1-one. InChIKey: KMIUVZZHUCKSJZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | 1-(4-bromo-3-nitrophenyl)butan-1-one |
| InChIKey | KMIUVZZHUCKSJZ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)