Products 91721-00-5
CAS 91721-00-5 is the registry number for Ethyl 2-(2-acetyl-5-bromophenoxy)acetate, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 250mg.
Ethyl 2-(2-acetyl-5-bromophenoxy)acetate (CAS 91721-00-5) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: ethyl 2-(2-acetyl-5-bromophenoxy)acetate. InChIKey: PGUVXOSOXJYRQT-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | ethyl 2-(2-acetyl-5-bromophenoxy)acetate |
| InChIKey | PGUVXOSOXJYRQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C(C=CC(=C1)Br)C(=O)C |
Computed by PubChem (NCBI)