CAS 917388-49-9 is the registry number for 3-(3,4-Dimethoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 917388-49-9) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: SWNHHMDHMKWXMX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | SWNHHMDHMKWXMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=C(C=C2)OC)OC)C(=O)O |
Computed by PubChem (NCBI)