CAS 91761-17-0 is the registry number for 3-​((1,​1-​dioxido-​2-​isothiazolidinyl)​methyl)​-benzenamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]aniline (CAS 91761-17-0) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]aniline. InChIKey: MBLFIXCDPMDGKU-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]aniline |
| InChIKey | MBLFIXCDPMDGKU-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)