Products 917978-58-6

CAS 917978-58-6 is the registry number for 2,5-dioxopyrrolidin-1-yl 1H-indole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 1H-indole-3-carboxylate (CAS 917978-58-6) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 1H-indole-3-carboxylate. InChIKey: POYASVGHMJOYDC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10N2O4
Molecular weight258.23 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 1H-indole-3-carboxylate
InChIKeyPOYASVGHMJOYDC-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)C2=CNC3=CC=CC=C32

Computed by PubChem (NCBI)