CAS 917978-58-6 is the registry number for 2,5-dioxopyrrolidin-1-yl 1H-indole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) 1H-indole-3-carboxylate (CAS 917978-58-6) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 1H-indole-3-carboxylate. InChIKey: POYASVGHMJOYDC-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 1H-indole-3-carboxylate |
| InChIKey | POYASVGHMJOYDC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)