CAS 918344-20-4 is the registry number for 4-Hydroxy-Alpha-(1-hydroxycyclohexyl)benzeneacetonitrile. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)acetonitrile (CAS 918344-20-4) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: 2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)acetonitrile. InChIKey: HVHRRFPUUJSPLA-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)acetonitrile |
| InChIKey | HVHRRFPUUJSPLA-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(C#N)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)