CAS 918488-41-2 appears in our catalog under these names: 5–Chloroisoquinolin–6–ol, 5-Chloroisoquinolin-6-ol, 97%, 97%, 5-Chloroisoquinolin-6-ol, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-chloroisoquinolin-6-ol (CAS 918488-41-2) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 5-chloroisoquinolin-6-ol. InChIKey: ALTPGTZNQQAMJI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-chloroisoquinolin-6-ol |
| InChIKey | ALTPGTZNQQAMJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=NC=C2)Cl)O |
Computed by PubChem (NCBI)