CAS 918502-72-4 appears in our catalog under these names: rac Enterolactone -13C3, Enterolactone-13C3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 2mg, 10mg, 25 mg, 2.5 mg.
(3S)-3,4-bis[(3-hydroxyphenyl)methyl](2,3,5-13C3)oxolan-2-one (CAS 918502-72-4) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 301.31 g/mol. IUPAC name: (3S)-3,4-bis[(3-hydroxyphenyl)methyl](2,3,5-13C3)oxolan-2-one. InChIKey: HVDGDHBAMCBBLR-AQPGKPQVSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 301.31 g/mol |
| IUPAC name | (3S)-3,4-bis[(3-hydroxyphenyl)methyl](2,3,5-13C3)oxolan-2-one |
| InChIKey | HVDGDHBAMCBBLR-AQPGKPQVSA-N |
| SMILES | [13CH2]1C([13C@@H]([13C](=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)