CAS 918524-86-4 appears in our catalog under these names: 2,5-Difluoro-4-(phenylmethoxy)benzaldehyde, 2,5-Difluoro-4-(phenylmethoxy)benzaldehyde, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
2,5-difluoro-4-phenylmethoxybenzaldehyde (CAS 918524-86-4) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,5-difluoro-4-phenylmethoxybenzaldehyde. InChIKey: HGQMDQSECDSZEZ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2,5-difluoro-4-phenylmethoxybenzaldehyde |
| InChIKey | HGQMDQSECDSZEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)F)C=O)F |
Computed by PubChem (NCBI)