Products 918524-93-3
CAS 918524-93-3 appears in our catalog under these names: 4-(Benzyloxy)-2,6-difluorobenzaldehyde, 97%, 4–(Benzyloxy)–2，6–difluorobenzaldehyde, 4-(Benzyloxy)-2,6-difluorobenzaldehyde, 98%, 98%, 4-(Benzyloxy)-2,6-difluorobenzaldehyde, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
2,6-difluoro-4-phenylmethoxybenzaldehyde (CAS 918524-93-3) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,6-difluoro-4-phenylmethoxybenzaldehyde. InChIKey: XLTBPFVUDIRJRR-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2,6-difluoro-4-phenylmethoxybenzaldehyde |
| InChIKey | XLTBPFVUDIRJRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C(=C2)F)C=O)F |
Computed by PubChem (NCBI)