CAS 918642-61-2 appears in our catalog under these names: Cabozantinib Impurity 2, 1-[(2-FLUOROPHENYL)CARBAMOYL]CYCLOPROPANECARBOXYLIC ACID, 98%, 1-((2-Fluorophenyl)Carbamoyl)Cyclopropanecarboxylic Acid, 98%, 98%, Cabozantinib Impurity 5, Cabozantinib impurity 1, 99.93%. Offered by: Chemat Brand, Fluorochem, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 100mg, 250mg, 1g, 5g, 1 g, 500 mg.
1-[(2-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 918642-61-2) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 1-[(2-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: WSDNYZVNBWULFS-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | WSDNYZVNBWULFS-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)