CAS 91902-60-2 is the registry number for Methyl 6-methyl-1-naphthoate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 6-methylnaphthalene-1-carboxylate (CAS 91902-60-2) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: methyl 6-methylnaphthalene-1-carboxylate. InChIKey: QKPWHTVLSINHGS-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | methyl 6-methylnaphthalene-1-carboxylate |
| InChIKey | QKPWHTVLSINHGS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)