Products 92-20-6
CAS 92-20-6 is the registry number for N-(2,5-Dimethoxy-4-nitrophenyl)benzamide, 97%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
N-(2,5-dimethoxy-4-nitrophenyl)benzamide (CAS 92-20-6) is a chemical compound with the molecular formula C15H14N2O5 and a molecular weight of 302.28 g/mol. IUPAC name: N-(2,5-dimethoxy-4-nitrophenyl)benzamide. InChIKey: JCKZOGUHQXHGTO-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O5 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | N-(2,5-dimethoxy-4-nitrophenyl)benzamide |
| InChIKey | JCKZOGUHQXHGTO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1NC(=O)C2=CC=CC=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)