CAS 92088-75-0 is the registry number for 1-Methyl-3-(4-nitrophenyl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-3-(4-nitrophenyl)imidazolidine-2,4-dione (CAS 92088-75-0) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 1-methyl-3-(4-nitrophenyl)imidazolidine-2,4-dione. InChIKey: GMETUHFKFADYGW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 1-methyl-3-(4-nitrophenyl)imidazolidine-2,4-dione |
| InChIKey | GMETUHFKFADYGW-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N(C1=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)