CAS 92190-51-7 appears in our catalog under these names: 2-Isopropoxy-1-naphthoic acid, 95%, 2-(Propan-2-yloxy)naphthalene-1-carboxylic acid, ≥95%, ≥95%, 2-(Propan-2-yloxy)naphthalene-1-carboxylic acid, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
2-propan-2-yloxynaphthalene-1-carboxylic acid (CAS 92190-51-7) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 2-propan-2-yloxynaphthalene-1-carboxylic acid. InChIKey: GGQJMQFURUJRGT-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-propan-2-yloxynaphthalene-1-carboxylic acid |
| InChIKey | GGQJMQFURUJRGT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)