CAS 92199-13-8 is the registry number for 3-Methylbiphenyl-2-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-methyl-6-phenylbenzamide (CAS 92199-13-8) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 2-methyl-6-phenylbenzamide. InChIKey: KWWUNVBFECASHS-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-methyl-6-phenylbenzamide |
| InChIKey | KWWUNVBFECASHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)