CAS 92210-41-8 is the registry number for 2(1H)-Quinazolinone, 5,6-dimethoxy-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5,6-dimethoxy-1H-quinazolin-2-one (CAS 92210-41-8) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 5,6-dimethoxy-1H-quinazolin-2-one. InChIKey: IDKXKBBJERCUMF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 5,6-dimethoxy-1H-quinazolin-2-one |
| InChIKey | IDKXKBBJERCUMF-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC(=O)N=C2)OC |
Computed by PubChem (NCBI)