CAS 92251-80-4 is the registry number for (2-Oxo-3-phenylcyclohexyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
2-(2-oxo-3-phenylcyclohexyl)acetic acid (CAS 92251-80-4) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 2-(2-oxo-3-phenylcyclohexyl)acetic acid. InChIKey: WTBDYAFOVHATCN-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 2-(2-oxo-3-phenylcyclohexyl)acetic acid |
| InChIKey | WTBDYAFOVHATCN-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C(C1)C2=CC=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)