CAS 923226-48-6 appears in our catalog under these names: 6-Chloro-N-cyclopropylpyridine-3-sulfonamide, 6-Chloro-N-cyclopropylpyridine-3-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
6-chloro-N-cyclopropylpyridine-3-sulfonamide (CAS 923226-48-6) is a chemical compound with the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. IUPAC name: 6-chloro-N-cyclopropylpyridine-3-sulfonamide. InChIKey: JLCDCYNJKALDJO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2S |
|---|---|
| Molecular weight | 232.69 g/mol |
| IUPAC name | 6-chloro-N-cyclopropylpyridine-3-sulfonamide |
| InChIKey | JLCDCYNJKALDJO-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)