CAS 923716-91-0 is the registry number for 5-Bromo-N,3-dimethylbenzofuran-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N,3-dimethyl-1-benzofuran-2-carboxamide (CAS 923716-91-0) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 5-bromo-N,3-dimethyl-1-benzofuran-2-carboxamide. InChIKey: CYHYVFUZWYCGIP-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 5-bromo-N,3-dimethyl-1-benzofuran-2-carboxamide |
| InChIKey | CYHYVFUZWYCGIP-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)Br)C(=O)NC |
Computed by PubChem (NCBI)