Products 92385-44-9
CAS 92385-44-9 appears in our catalog under these names: 3-(2-Aminoethoxy)aniline dihydrochloride, 97%, 3-(2-Aminoethoxy)aniline dihydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
3-(2-aminoethoxy)aniline;dihydrochloride (CAS 92385-44-9) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 3-(2-aminoethoxy)aniline;dihydrochloride. InChIKey: AZEKWMJMXNTQOZ-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 3-(2-aminoethoxy)aniline;dihydrochloride |
| InChIKey | AZEKWMJMXNTQOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCCN)N.Cl.Cl |
Computed by PubChem (NCBI)