Products 924663-39-8
CAS 924663-39-8 appears in our catalog under these names: Rabeprazole Impurity 41, Rabeprazole Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium (CAS 924663-39-8) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium. InChIKey: FEEQDQKECPZTPQ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium |
| InChIKey | FEEQDQKECPZTPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1CCl)[O-])OCCCOC |
Computed by PubChem (NCBI)