Products 92496-64-5
CAS 92496-64-5 is the registry number for Cyproheptadine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
9,10-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one (CAS 92496-64-5) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 9,10-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one. InChIKey: AVHKWKJVWBLNPQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 9,10-dihydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one |
| InChIKey | AVHKWKJVWBLNPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(C3=CC=CC=C3C2=O)O)O |
Computed by PubChem (NCBI)