CAS 92534-69-5 appears in our catalog under these names: 1–Methyl–4–nitro–1H–pyrazole–5–carboxylic acid, 1-Methyl-4-nitro-1H-pyrazole-5-carboxylic acid, 97%, 97%, 1-Methyl-4-nitro-1H-pyrazole-5-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g.
1-methyl-4-nitropyrazole-5-carboxylic acid (CAS 92534-69-5) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-5-carboxylic acid. InChIKey: ANGMMUPJSXUXGY-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 1-methyl-4-nitropyrazole-5-carboxylic acid |
| InChIKey | ANGMMUPJSXUXGY-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)