CAS 926016-42-4 is the registry number for 1-(4,6-Dimethylpyrimidin-2-yl)-5-methyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazole-3-carboxylic acid (CAS 926016-42-4) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: 1-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazole-3-carboxylic acid. InChIKey: CGTWWBOASFVOGB-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | 1-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazole-3-carboxylic acid |
| InChIKey | CGTWWBOASFVOGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2C(=CC(=N2)C(=O)O)C)C |
Computed by PubChem (NCBI)